Showing Metabocard for O-phospho-L-serine (BASm0002768)
| Common Name | O-phospho-l-serine |
|---|---|
| Description | DL-O-Phosphoserine, also known as DL-O-phosphorylserine or DL-O-serine phosphate, belongs to the class of organic compounds known as alpha amino acids. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Serine proteases are a common type of protease. DL-O-Phosphoserine exists in all living species, ranging from bacteria to humans. Serine is one of three amino acid residues that are commonly phosphorylated by kinases during cell signalling in eukaryotes. |
| Structure | |
| Molecular Formula | C3H8NO6P |
| Average Mass | 185.07250 |
| Monoisotopic Mass | 185.00892 |
| IUPAC Name | 2-amino-3-(phosphonooxy)propanoic acid |
| Traditional Name | Phosphoserine |
| CAS Registry Number | 17885-08-04 |
| SMILES | [NH3+][C@@H](COP(=O)([O-])[O-])C(=O)[O-] |
| InChI Identifier | InChI=1S/C3H8NO6P/c4-2(3(5)6)1-10-11(7,8)9/h2H,1,4H2,(H,5,6)(H2,7,8,9) |
| InChI Key | BZQFBWGGLXLEPQ-UHFFFAOYSA-N |
| CHEBI ID | CHEBI:57524 |
| HMDB ID | HMDB0001721 |
| State | Solid |
| Water Solubility | 1.99e+01 g/l |
| logP | -2.32 |
| logS | -0.97 |
| pKa (Strongest Acidic) | 1.20 |
| pKa (Strongest Basic) | 9.39 |
| Hydrogen Acceptor Count | 6 |
| Hydrogen Donor Count | 4 |
| Polar Surface Area | 130.08 Ų |
| Rotatable Bond Count | 4 |
| Physiological Charge | -2 |
| Formal Charge | 0 |
| Refractivity | 32.91 m³·mol⁻¹ |
| Polarizability | 14.01 |