Showing Metabocard for (S)-3-hydroxybutanoate (BASm0000239)
| Common Name | (s)-3-hydroxybutanoate |
|---|---|
| Description | (S)-3-Hydroxybutyric acid is a normal human metabolite that has been found elevated in geriatric patients remitting from depression (PMID: 17048218 ). 3-Hydroxybutyric acid is a ketone body. Like the other ketone bodies (acetoacetate and acetone), levels of 3-hydroxybutyric acid are raised in ketosis. In humans, 3-hydroxybutyric acid is synthesized in the liver from acetyl-CoA, and can be used as an energy source by the brain when blood glucose is low. |
| Structure | |
| Molecular Formula | C4H8O3 |
| Average Mass | 104.10450 |
| Monoisotopic Mass | 104.04734 |
| IUPAC Name | (3S)-3-hydroxybutanoic acid |
| Traditional Name | (s)-3-hydroxybutyric acid |
| CAS Registry Number | 6168-83-8 |
| SMILES | C[C@H](O)CC(=O)[O-] |
| InChI Identifier | InChI=1S/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7)/t3-/m0/s1 |
| InChI Key | WHBMMWSBFZVSSR-VKHMYHEASA-N |
| CHEBI ID | CHEBI:11047 |
| HMDB ID | HMDB0000442 |
| State | Solid |
| Water Solubility | 5.39e+02 g/l |
| logP | -0.50 |
| logS | 0.71 |
| pKa (Strongest Acidic) | 4.41 |
| pKa (Strongest Basic) | -2.62 |
| Hydrogen Acceptor Count | 3 |
| Hydrogen Donor Count | 2 |
| Polar Surface Area | 57.53 Ų |
| Rotatable Bond Count | 2 |
| Physiological Charge | -1 |
| Formal Charge | 0 |
| Refractivity | 23.46 m³·mol⁻¹ |
| Polarizability | 9.94 |