Showing Metabocard for (1S,5R)-carveol (BASm0000330)
| Common Name | (1s,5r)-carveol |
|---|---|
| Description | Carveol is a natural terpenoid alcohol that is a constituent of spearmint oil. It has an odor and flavor that resemble those of spearmint and caraway. Consequently, it is used as a fragrance in cosmetics and as a flavor additive in the food industry. |
| Structure | |
| Molecular Formula | C10H16O |
| Average Mass | 152.23340 |
| Monoisotopic Mass | 152.12012 |
| IUPAC Name | (1S,5R)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-ol |
| Traditional Name | (-)-trans-carveol |
| CAS Registry Number | 2102-58-1 |
| SMILES | C=C(C)[C@@H]1CC=C(C)[C@@H](O)C1 |
| InChI Identifier | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9-11H,1,5-6H2,2-3H3/t9-,10+/m1/s1 |
| InChI Key | BAVONGHXFVOKBV-ZJUUUORDSA-N |
| CHEBI ID | CHEBI:15389 |
| HMDB ID | HMDB0003450 |
| State | Solid |
| Water Solubility | 2.82e+00 g/l |
| logP | 2.41 |
| logS | -1.73 |
| pKa (Strongest Acidic) | 18.21 |
| pKa (Strongest Basic) | -1.40 |
| Hydrogen Acceptor Count | 1 |
| Hydrogen Donor Count | 1 |
| Polar Surface Area | 20.23 Ų |
| Rotatable Bond Count | 1 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 48.00 m³·mol⁻¹ |
| Polarizability | 18.00 |