Showing Metabocard for (R)-carvone (BASm0000340)
| Common Name | (r)-carvone |
|---|---|
| Description | (S)-2-methyl-5-(1-Methylethenyl)-2-cyclohexen-1-one belongs to the class of organic compounds known as menthane monoterpenoids. These are monoterpenoids with a structure based on the o-, m-, or p-menthane backbone. P-menthane consists of the cyclohexane ring with a methyl group and a (2-methyl)-propyl group at the 1 and 4 ring position, respectively. The o- and m- menthanes are much rarer, and presumably arise by alkyl migration of p-menthanes. |
| Structure | |
| Molecular Formula | C10H14O |
| Average Mass | 150.21760 |
| Monoisotopic Mass | 150.10447 |
| IUPAC Name | (5R)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one |
| Traditional Name | (-)-carvone |
| CAS Registry Number | Not Available |
| SMILES | C=C(C)[C@@H]1CC=C(C)C(=O)C1 |
| InChI Identifier | InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9H,1,5-6H2,2-3H3/t9-/m1/s1 |
| InChI Key | ULDHMXUKGWMISQ-SECBINFHSA-N |
| CHEBI ID | CHEBI:15400 |
| HMDB ID | HMDB0061788 |
| State | Not Available |
| Water Solubility | 1.16e+00 g/l |
| logP | 2.77 |
| logS | -2.11 |
| pKa (Strongest Acidic) | Not Available |
| pKa (Strongest Basic) | -4.66 |
| Hydrogen Acceptor Count | 1 |
| Hydrogen Donor Count | 0 |
| Polar Surface Area | 17.07 Ų |
| Rotatable Bond Count | 1 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 47.17 m³·mol⁻¹ |
| Polarizability | 17.31 |