Showing Metabocard for (4aS,6R)-4a-hydroxy-L-erythro-5,6,7,8-tetrahydrobiopterin (BASm0000388)
Common Name | (4as,6r)-4a-hydroxy-l-erythro-5,6,7,8-tetrahydrobiopterin |
---|---|
Description | Tetrahydrobiopterin (BH4) is essential for catalyzing the conversion of phenylalanine into tyrosine by phenylalanine hydroxylase. During this physiological reaction, the oxidation of BH4 creates 4a-hydroxytetrahydropterin (CAS: 70110-58-6) intermediates and hydrogen peroxide is formed. The hydrogen peroxide and the hydroxytetrahydropterin can both be derived from alternate breakdown routes of a common precursor, the corresponding 4a-hydroperoxytetrahydropterin (PMID: 8323303 ). |
Structure | |
Molecular Formula | C9H15N5O4 |
Average Mass | 257.25000 |
Monoisotopic Mass | 257.11240 |
IUPAC Name | 2-amino-6-(1,2-dihydroxypropyl)-4a-hydroxy-4,4a,5,6,7,8-hexahydropteridin-4-one |
Traditional Name | 2-amino-6-(1,2-dihydroxypropyl)-4a-hydroxy-5,6,7,8-tetrahydropteridin-4-one |
CAS Registry Number | 1379003-93-6 |
SMILES | C[C@H](O)[C@H](O)[C@H]1CNC2=NC(N)=NC(=O)[C@]2(O)N1 |
InChI Identifier | InChI=1S/C9H15N5O4/c1-3(15)5(16)4-2-11-6-9(18,14-4)7(17)13-8(10)12-6/h3-5,14-16,18H,2H2,1H3,(H3,10,11,12,13,17)/t3-,4+,5-,9-/m0/s1 |
InChI Key | KJKIEFUPAPPGBC-XXKOCQOQSA-N |
CHEBI ID | CHEBI:15642 |
HMDB ID | HMDB0002281 |
Pathways | |
State | Solid |
Water Solubility | 4.81e+00 g/l |
logP | -2.29 |
logS | -1.73 |
pKa (Strongest Acidic) | 9.81 |
pKa (Strongest Basic) | 3.85 |
Hydrogen Acceptor Count | 9 |
Hydrogen Donor Count | 6 |
Polar Surface Area | 152.56 Ų |
Rotatable Bond Count | 2 |
Physiological Charge | 0 |
Formal Charge | 0 |
Refractivity | 58.60 m³·mol⁻¹ |
Polarizability | 24.20 |