Showing Metabocard for D-galactono-1,4-lactone (BASm0000456)
| Common Name | D-galactono-1,4-lactone |
|---|---|
| Description | Galactonolactone has been determined in human urine by reversed-phase HPLC for the specific evaluation of metabolic by-products in the urine of galactosemic patients and based on the simultaneous determination of gluconolactone, galactonolactone and galactitol. (PMID: 1797843 ). Patients with galactose-1-phosphate uridyltransferase (GALT) deficiency, given a load of galactose have been shown to excrete six times as much galactonate in their urine as normal subjects exposed to the same experimental conditions. The production of galactonate occurs through the activity of a soluble NAD+-dependent galactose dehydrogenase, catalyzing the conversion of galactose to D-galactonolactone (D-galactose: NAD+ oxidoreductase, EC 1.1.1.48). (OMMBID). |
| Structure | |
| Molecular Formula | C6H10O6 |
| Average Mass | 178.14000 |
| Monoisotopic Mass | 178.04774 |
| IUPAC Name | (3R,4S,5S,6R)-3,4,5,6-tetrahydroxyoxepan-2-one |
| Traditional Name | (3r,4s,5s,6r)-3,4,5,6-tetrahydroxyoxepan-2-one |
| CAS Registry Number | 2426-46-2 |
| SMILES | O=C1O[C@@H]([C@H](O)CO)[C@H](O)[C@H]1O |
| InChI Identifier | InChI=1S/C6H10O6/c7-2-1-12-6(11)5(10)4(9)3(2)8/h2-5,7-10H,1H2/t2-,3+,4+,5-/m1/s1 |
| InChI Key | WTXGYGWMPUGBAL-MGCNEYSASA-N |
| CHEBI ID | CHEBI:15895 |
| HMDB ID | HMDB0002541 |
| State | Not Available |
| Water Solubility | 5.83e+02 g/l |
| logP | -2.29 |
| logS | 0.51 |
| pKa (Strongest Acidic) | 11.61 |
| pKa (Strongest Basic) | -3.53 |
| Hydrogen Acceptor Count | 5 |
| Hydrogen Donor Count | 4 |
| Polar Surface Area | 107.22 Ų |
| Rotatable Bond Count | 0 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 34.78 m³·mol⁻¹ |
| Polarizability | 14.99 |