Showing Metabocard for dihydroxyacetone (BASm0000487)
| Common Name | Dihydroxyacetone |
|---|---|
| Description | Dihydroxyacetone (also known as DHA) is a ketotriose compound. Its addition to blood preservation solutions results in better maintenance of 2,3-diphosphoglycerate levels during storage. It is readily phosphorylated to dihydroxyacetone phosphate by triokinase in erythrocytes. In combination with naphthoquinones, it acts as a sunscreening agent. Dihydroxyacetone is the simplest of all ketoses and, having no chiral centre, is the only one that has no optical activity. Dihydroxyacetone is a simple non-toxic sugar. It is often derived from plant sources such as sugar beets and sugar cane, by the fermentation of glycerin. Dihydroxyacetone is a white crystalline powder which is water soluble. |
| Structure | |
| Molecular Formula | C3H6O3 |
| Average Mass | 90.07790 |
| Monoisotopic Mass | 90.03169 |
| IUPAC Name | 1,3-dihydroxypropan-2-one |
| Traditional Name | Dihydroxyacetone |
| CAS Registry Number | 96-26-4 |
| SMILES | O=C(CO)CO |
| InChI Identifier | InChI=1S/C3H6O3/c4-1-3(6)2-5/h4-5H,1-2H2 |
| InChI Key | RXKJFZQQPQGTFL-UHFFFAOYSA-N |
| CHEBI ID | CHEBI:16016 |
| HMDB ID | HMDB0001882 |
| State | Not Available |
| Water Solubility | 8.38e+02 g/l |
| logP | -1.65 |
| logS | 0.97 |
| pKa (Strongest Acidic) | 13.49 |
| pKa (Strongest Basic) | -3.32 |
| Hydrogen Acceptor Count | 3 |
| Hydrogen Donor Count | 2 |
| Polar Surface Area | 57.53 Ų |
| Rotatable Bond Count | 2 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 19.60 m³·mol⁻¹ |
| Polarizability | 8.13 |