Showing Metabocard for indole-3-acetamide (BASm0000493)
| Common Name | Indole-3-acetamide |
|---|---|
| Description | Indole-3-acetamide, also known as 2-(3-indolyl)acetamide or IAM, belongs to the class of organic compounds known as 3-alkylindoles. 3-Alkylindoles are compounds containing an indole moiety that carries an alkyl chain at the 3-position. Indole-3-acetamide has been detected, but not quantified, in several different foods, such as Alaska wild rhubarbs, lingonberries, butternut squash, pineapples, and agaves. Indole-3-acetamide is also found in the common pea and has been isolated from the etiolated seedlings of the black gram (Phaseolus mungo). |
| Structure | |
| Molecular Formula | C10H10N2O |
| Average Mass | 174.19920 |
| Monoisotopic Mass | 174.07931 |
| IUPAC Name | 2-(1H-indol-3-yl)ethanimidic acid |
| Traditional Name | Indole-3-acetamide |
| CAS Registry Number | 879-37-8 |
| SMILES | NC(=O)Cc1c[nH]c2ccccc12 |
| InChI Identifier | InChI=1S/C10H10N2O/c11-10(13)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,12H,5H2,(H2,11,13) |
| InChI Key | ZOAMBXDOGPRZLP-UHFFFAOYSA-N |
| CHEBI ID | CHEBI:16031 |
| HMDB ID | HMDB0029739 |
| State | Not Available |
| Water Solubility | 2.47e-01 g/l |
| logP | 1.09 |
| logS | -2.85 |
| pKa (Strongest Acidic) | 6.11 |
| pKa (Strongest Basic) | 8.48 |
| Hydrogen Acceptor Count | 2 |
| Hydrogen Donor Count | 3 |
| Polar Surface Area | 59.87 Ų |
| Rotatable Bond Count | 2 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 61.21 m³·mol⁻¹ |
| Polarizability | 18.12 |