Showing Metabocard for benzoate (BASm0000535)
| Common Name | Benzoate |
|---|---|
| Description | Benzoic acid, C6H5COOH, is a colourless crystalline solid and the simplest aromatic carboxylic acid. Benzoic acid occurs naturally free and bound as benzoic acid esters in many plant and animal species. Appreciable amounts have been found in most berries (around 0.05%). Cranberries contain as much as 300-1300 mg free benzoic acid per kg fruit. Benzoic acid is a fungistatic compound that is widely used as a food preservative. It often is conjugated to glycine in the liver and excreted as hippuric acid. Benzoic acid is a byproduct of phenylalanine metabolism in bacteria. It is also produced when gut bacteria process polyphenols (from ingested fruits or beverages). It can be found in Serratia (PMID:23061754 ). |
| Structure | |
| Molecular Formula | C7H6O2 |
| Average Mass | 122.12300 |
| Monoisotopic Mass | 122.03678 |
| IUPAC Name | benzoic acid |
| Traditional Name | Benzoic acid |
| CAS Registry Number | 65-85-0 |
| SMILES | O=C([O-])c1ccccc1 |
| InChI Identifier | InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9) |
| InChI Key | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
| CHEBI ID | CHEBI:16150 |
| HMDB ID | HMDB0001870 |
| State | Not Available |
| Water Solubility | 7.08e+00 g/l |
| logP | 1.72 |
| logS | -1.24 |
| pKa (Strongest Acidic) | 4.08 |
| pKa (Strongest Basic) | Not Available |
| Hydrogen Acceptor Count | 2 |
| Hydrogen Donor Count | 1 |
| Polar Surface Area | 37.3 Ų |
| Rotatable Bond Count | 1 |
| Physiological Charge | -1 |
| Formal Charge | 0 |
| Refractivity | 33.31 m³·mol⁻¹ |
| Polarizability | 11.97 |