Showing Metabocard for 9H-fluoren-9-ol (BASm0000782)
| Common Name | 9h-fluoren-9-ol |
|---|---|
| Description | This compound belongs to the family of Fluorenes. These are compounds containing a fluorene moiety, which consists of two benzene rings connected through either a cyclopentane, cyclopentene, or cyclopenta-1,3-diene. |
| Structure | |
| Molecular Formula | C13H10O |
| Average Mass | 182.21790 |
| Monoisotopic Mass | 182.07316 |
| IUPAC Name | 9H-fluoren-9-ol |
| Traditional Name | Fluorenol |
| CAS Registry Number | Not Available |
| SMILES | OC1c2ccccc2-c2ccccc21 |
| InChI Identifier | InChI=1S/C13H10O/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13-14H |
| InChI Key | AFMVESZOYKHDBJ-UHFFFAOYSA-N |
| CHEBI ID | CHEBI:16904 |
| HMDB ID | HMDB0059803 |
| State | Not Available |
| Water Solubility | 4.32e-01 g/l |
| logP | 2.58 |
| logS | -2.63 |
| pKa (Strongest Acidic) | 13.90 |
| pKa (Strongest Basic) | -3.28 |
| Hydrogen Acceptor Count | 1 |
| Hydrogen Donor Count | 1 |
| Polar Surface Area | 20.23 Ų |
| Rotatable Bond Count | 0 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 56.23 m³·mol⁻¹ |
| Polarizability | 20.12 |