Showing Metabocard for 4-maleylacetoacetate (BASm0000845)
Common Name | 4-maleylacetoacetate |
---|---|
Description | Maleylacetoacetic acid, also known as 4-maleylacetoacetate, is an intermediate in the metabolism of tyrosine. Homogentisate 1,2-dioxygenase (HGD) is the enzyme which catalyzes the conversion of homogentisate into 4-maleylacetoacetate. HGD is involved in the catabolism of aromatic rings, more specifically in the breakdown of the amino acids tyrosine and phenylalanine. |
Structure | |
Molecular Formula | C8H8O6 |
Average Mass | 200.14550 |
Monoisotopic Mass | 200.03209 |
IUPAC Name | (2Z)-4,6-dioxooct-2-enedioic acid |
Traditional Name | Maleylacetoacetic acid |
CAS Registry Number | 5698-52-2 |
SMILES | O=C([O-])/C=C\C(=O)CC(=O)CC(=O)[O-] |
InChI Identifier | InChI=1S/C8H8O6/c9-5(1-2-7(11)12)3-6(10)4-8(13)14/h1-2H,3-4H2,(H,11,12)(H,13,14)/b2-1- |
InChI Key | GACSIVHAIFQKTC-UPHRSURJSA-N |
CHEBI ID | CHEBI:17105 |
HMDB ID | HMDB0002052 |
Pathways | |
State | Solid |
Water Solubility | 1.65e+00 g/l |
logP | -0.19 |
logS | -2.08 |
pKa (Strongest Acidic) | 2.72 |
pKa (Strongest Basic) | -7.06 |
Hydrogen Acceptor Count | 6 |
Hydrogen Donor Count | 2 |
Polar Surface Area | 108.74 Ų |
Rotatable Bond Count | 6 |
Physiological Charge | -2 |
Formal Charge | 0 |
Refractivity | 44.40 m³·mol⁻¹ |
Polarizability | 16.75 |