Showing Metabocard for (S)-4-hydroxymandelate (BASm0000884)
| Common Name | (s)-4-hydroxymandelate |
|---|---|
| Description | p-Hydroxymandelic acid is an acidic metabolite of p-octopamine and p-synephrine (p-phenylephrine). It is also a naturally occurring metabolite of tyramine. A specific enantiomer of p-hydroxymandelic aicd ((R)-(-)-p-hydroxymandelic -- also called pisolithin B) has been shown to exhibit antifungal properties. |
| Structure | |
| Molecular Formula | C8H8O4 |
| Average Mass | 168.14670 |
| Monoisotopic Mass | 168.04226 |
| IUPAC Name | 2-hydroxy-2-(4-hydroxyphenyl)acetic acid |
| Traditional Name | 4-hydroxymandelic acid |
| CAS Registry Number | 1198-84-1 |
| SMILES | O=C([O-])[C@@H](O)c1ccc(O)cc1 |
| InChI Identifier | InChI=1S/C8H8O4/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,7,9-10H,(H,11,12) |
| InChI Key | YHXHKYRQLYQUIH-UHFFFAOYSA-N |
| CHEBI ID | CHEBI:17210 |
| HMDB ID | HMDB0000822 |
| State | Solid |
| Water Solubility | 7.69e+00 g/l |
| logP | 0.86 |
| logS | -1.34 |
| pKa (Strongest Acidic) | 3.30 |
| pKa (Strongest Basic) | -4.11 |
| Hydrogen Acceptor Count | 4 |
| Hydrogen Donor Count | 3 |
| Polar Surface Area | 77.76 Ų |
| Rotatable Bond Count | 2 |
| Physiological Charge | -1 |
| Formal Charge | 0 |
| Refractivity | 40.68 m³·mol⁻¹ |
| Polarizability | 15.64 |