Showing Metabocard for 5'-deoxyadenosine (BASm0000924)
| Common Name | 5'-deoxyadenosine |
|---|---|
| Description | 5'-Deoxyadenosine is an oxidized nucleoside found in the urine of normal subjects. Oxidized nucleosides represent excellent biomarkers for determining the extent of damage in genetic material, which has long been of interest in understanding the mechanism of aging, neurodegenerative diseases, and carcinogenesis. (PMID 15116424 ). The normal form of deoxyadenosine used in DNA synthesis and repair is 2'-deoxyadenosine where the hydroxyl group (-OH) is at the 2' position of its ribose sugar moiety. 5'-deoxyadenosine has its hydroxyl group at the 5' position of the ribose sugar. |
| Structure | |
| Molecular Formula | C10H13N5O3 |
| Average Mass | 251.24190 |
| Monoisotopic Mass | 251.10184 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-amino-9H-purin-9-yl)-5-methyloxolane-3,4-diol |
| Traditional Name | 5'-deoxyadenosine |
| CAS Registry Number | 4754-39-6 |
| SMILES | C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI Identifier | InChI=1S/C10H13N5O3/c1-4-6(16)7(17)10(18-4)15-3-14-5-8(11)12-2-13-9(5)15/h2-4,6-7,10,16-17H,1H3,(H2,11,12,13)/t4-,6-,7-,10-/m1/s1 |
| InChI Key | XGYIMTFOTBMPFP-KQYNXXCUSA-N |
| CHEBI ID | CHEBI:17319 |
| HMDB ID | HMDB0001983 |
| State | Not Available |
| Water Solubility | 9.88e+00 g/l |
| logP | -0.52 |
| logS | -1.41 |
| pKa (Strongest Acidic) | 12.48 |
| pKa (Strongest Basic) | 4.99 |
| Hydrogen Acceptor Count | 7 |
| Hydrogen Donor Count | 3 |
| Polar Surface Area | 119.31 Ų |
| Rotatable Bond Count | 1 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 61.65 m³·mol⁻¹ |
| Polarizability | 24.26 |