Showing Metabocard for reduced riboflavin (BASm0001023)
| Common Name | Reduced riboflavin |
|---|---|
| Description | Riboflavin reduced is an intermediate in the metabolism of Porphyrin and chlorophyll. It is a substrate for Flavin reductase. |
| Structure | |
| Molecular Formula | C15H16N4O6 |
| Average Mass | 348.31070 |
| Monoisotopic Mass | 348.10698 |
| IUPAC Name | 10-[(2R,3R,4R)-2,3,4,5-tetrahydroxypentyl]-2H,3H,4H,10H-benzo[g]pteridine-2,4-dione |
| Traditional Name | 10-[(2r,3r,4r)-2,3,4,5-tetrahydroxypentyl]-3h-benzo[g]pteridine-2,4-dione |
| CAS Registry Number | 101652-10-2 |
| SMILES | Cc1cc2c(cc1C)N(C[C@H](O)[C@H](O)[C@H](O)CO)c1[nH]c(=O)[nH]c(=O)c1N2 |
| InChI Identifier | InChI=1S/C15H16N4O6/c20-6-10(22)12(23)9(21)5-19-8-4-2-1-3-7(8)16-11-13(19)17-15(25)18-14(11)24/h1-4,9-10,12,20-23H,5-6H2,(H,18,24,25)/t9-,10-,12-/m1/s1 |
| InChI Key | ATANIONNQLTUND-CKYFFXLPSA-N |
| CHEBI ID | CHEBI:17607 |
| HMDB ID | HMDB0001557 |
| State | Solid |
| Water Solubility | 4.76e-01 g/l |
| logP | -1.64 |
| logS | -2.86 |
| pKa (Strongest Acidic) | 6.97 |
| pKa (Strongest Basic) | 0.55 |
| Hydrogen Acceptor Count | 9 |
| Hydrogen Donor Count | 5 |
| Polar Surface Area | 155.05 Ų |
| Rotatable Bond Count | 5 |
| Physiological Charge | -1 |
| Formal Charge | 0 |
| Refractivity | 86.19 m³·mol⁻¹ |
| Polarizability | 33.24 |