Showing Metabocard for D-mannonate (BASm0001072)
| Common Name | D-mannonate |
|---|---|
| Description | D-altronate is a member of the chemical class known as Sugar Acids and Derivatives. These are compounds containing a saccharide unit which bears a carboxylic acid group. |
| Structure | |
| Molecular Formula | C6H12O7 |
| Average Mass | 196.15530 |
| Monoisotopic Mass | 196.05830 |
| IUPAC Name | (2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid |
| Traditional Name | D-altronic acid |
| CAS Registry Number | Not Available |
| SMILES | O=C([O-])[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI Identifier | InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3-,4-,5+/m1/s1 |
| InChI Key | RGHNJXZEOKUKBD-AIHAYLRMSA-N |
| CHEBI ID | CHEBI:17767 |
| State | Not Available |
| Water Solubility | 1.59e+02 g/l |
| logP | -2.57 |
| logS | -0.09 |
| pKa (Strongest Acidic) | Not Available |
| pKa (Strongest Basic) | Not Available |
| Hydrogen Acceptor Count | 7 |
| Hydrogen Donor Count | 6 |
| Polar Surface Area | 138.45 Ų |
| Rotatable Bond Count | 5 |
| Physiological Charge | Not Available |
| Formal Charge | 0 |
| Refractivity | 38.27 m³·mol⁻¹ |
| Polarizability | 16.95 |