Showing Metabocard for QH(2) (BASm0001144)
Common Name | Qh(2) |
---|---|
Description | Qh(2) is part of the Oxidative phosphorylation, Cardiac muscle contraction, Alzheimer's disease, Parkinson's disease, and Huntington's disease pathways. It is a substrate for: Cytochrome b-c1 complex subunit Rieske, mitochondrial. |
Structure | |
Molecular Formula | C14H20O4 |
Average Mass | 252.30620 |
Monoisotopic Mass | 252.13616 |
IUPAC Name | 2,3-dimethoxy-5-methyl-6-(3-methylbut-2-en-1-yl)benzene-1,4-diol |
Traditional Name | 2,3-dimethoxy-5-methyl-6-(3-methylbut-2-en-1-yl)benzene-1,4-diol |
CAS Registry Number | Not Available |
SMILES | COc1c(O)c(C)c(CC=C(C)C)c(O)c1OC |
InChI Identifier | InChI=1S/C14H20O4/c1-8(2)6-7-10-9(3)11(15)13(17-4)14(18-5)12(10)16/h6,15-16H,7H2,1-5H3 |
InChI Key | TVLSKGDBUQMDPR-UHFFFAOYSA-N |
CHEBI ID | CHEBI:17976 |
HMDB ID | HMDB0059661 |
Pathways | |
State | Solid |
Water Solubility | 3.06e-01 g/l |
logP | 2.70 |
logS | -2.92 |
pKa (Strongest Acidic) | 10.27 |
pKa (Strongest Basic) | -4.66 |
Hydrogen Acceptor Count | 4 |
Hydrogen Donor Count | 2 |
Polar Surface Area | 58.92 Ų |
Rotatable Bond Count | 4 |
Physiological Charge | 0 |
Formal Charge | 0 |
Refractivity | 72.23 m³·mol⁻¹ |
Polarizability | 27.92 |