Showing Metabocard for triphosphate (BASm0001167)
| Common Name | Triphosphate |
|---|---|
| Description | A triphosphate is a salt or ester containing three phosphate groups. It is the ionic form of triphosphoric acid, a condensed form of phosphoric acid. Triphosphate is an intermediate in the biosynthesis of Folate, the metabolism of purine, the metabolism of Porphyrin, the metabolism of Pyrimidine and the metabolism of Thiamine. The cleavage of the high energy triphosphate bonds in ATP (to ADP or AMP) is the central route of generating energy in cells. |
| Structure | |
| Molecular Formula | O10P3 |
| Average Mass | 252.91530 |
| Monoisotopic Mass | 252.87043 |
| IUPAC Name | {[hydroxy(phosphonooxy)phosphoryl]oxy}phosphonic acid |
| Traditional Name | [hydroxy(phosphonooxy)phosphoryl]oxyphosphonic acid |
| CAS Registry Number | 14127-68-5 |
| SMILES | O=P([O-])([O-])OP(=O)([O-])OP(=O)([O-])[O-] |
| InChI Identifier | InChI=1S/H5O10P3/c1-11(2,3)9-13(7,8)10-12(4,5)6/h(H,7,8)(H2,1,2,3)(H2,4,5,6)/p-5 |
| InChI Key | UNXRWKVEANCORM-UHFFFAOYSA-I |
| CHEBI ID | CHEBI:18036 |
| HMDB ID | HMDB03379 |
| MiMeDB ID | MMDBc0029710 |
| State | Solid |
| Water Solubility | Not Available |
| logS | Not Available |
| pKa (Strongest Acidic) | 0.89 |
| pKa (Strongest Basic) | Not Available |
| Hydrogen Acceptor Count | 8 |
| Hydrogen Donor Count | 5 |
| Polar Surface Area | 170.82 Ų |
| Rotatable Bond Count | 4 |
| Physiological Charge | -3 |
| Formal Charge | 0 |
| Refractivity | 36.40 m³·mol⁻¹ |
| Polarizability | 14.56 |