Showing Metabocard for beta-D-ribopyranose (BASm0001393)
| Common Name | Beta-d-ribopyranose |
|---|---|
| Description | beta-D-Ribopyranose is the pyranose form of beta-D-Ribose. D-Ribose, commonly referred to as simply ribose, is a five-carbon sugar found in all living cells. Ribose is not an essential nutrient because it can be synthesized by almost every tissue in the body from other substances, such as glucose. It is vital for life as a component of DNA, RNA, ATP, ADP, and AMP. |
| Structure | |
| Molecular Formula | C5H10O5 |
| Average Mass | 150.12990 |
| Monoisotopic Mass | 150.05282 |
| IUPAC Name | (2R,3R,4R,5R)-oxane-2,3,4,5-tetrol |
| Traditional Name | Β-d-ribopyranose |
| CAS Registry Number | 7296-60-8 |
| SMILES | O[C@@H]1[C@H](O)[C@H](O)CO[C@H]1O |
| InChI Identifier | InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4-,5-/m1/s1 |
| InChI Key | SRBFZHDQGSBBOR-TXICZTDVSA-N |
| CHEBI ID | CHEBI:27476 |
| HMDB ID | HMDB0012194 |
| State | Solid |
| Water Solubility | 1.22e+03 g/l |
| logP | -2.57 |
| logS | 0.91 |
| pKa (Strongest Acidic) | 11.31 |
| pKa (Strongest Basic) | -3.53 |
| Hydrogen Acceptor Count | 5 |
| Hydrogen Donor Count | 4 |
| Polar Surface Area | 90.15 Ų |
| Rotatable Bond Count | 0 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 29.96 m³·mol⁻¹ |
| Polarizability | 13.21 |