Showing Metabocard for alpha-pinene oxide (BASm0001666)
| Common Name | Alpha-pinene oxide |
|---|---|
| Description | Alpha-pinene oxide is cheap monoterpene, which is important compound for the fragnance industry. Biocatalytic method is used to convert monoterpenes into terpenoids. The biotransformation of alpha-pinene oxide using resting cells of Pseudomonas fluorescens NCIMB 11671 produces isonovalal (cis-2-methyl-5-isopropylhexa-2,5-dienal), which is a fragrance. However, this biotransformation has technical problems including the following: alpha-pinene oxide undergoes autoxidation in water and light; it is hydrophobic and relatively toxic to the biocatalyst; and it suffers from product inhibition. the influence of other terpene byproducts on the flux of alpha-pinene oxide was investigated and found to decrease the flux into the organic phase by up to 10%. (PMID: 16321051 ). |
| Structure | |
| Molecular Formula | C10H16O |
| Average Mass | 152.23340 |
| Monoisotopic Mass | 152.12012 |
| IUPAC Name | 2,7,7-trimethyl-3-oxatricyclo[4.1.1.0^{2,4}]octane |
| Traditional Name | Α-pinene oxide |
| CAS Registry Number | 1686-14-2 |
| SMILES | CC1(C)C2CC3OC3(C)C1C2 |
| InChI Identifier | InChI=1S/C10H16O/c1-9(2)6-4-7(9)10(3)8(5-6)11-10/h6-8H,4-5H2,1-3H3 |
| InChI Key | NQFUSWIGRKFAHK-UHFFFAOYSA-N |
| CHEBI ID | CHEBI:29060 |
| HMDB ID | HMDB0003667 |
| State | Not Available |
| Water Solubility | 8.55e-02 g/l |
| logP | 2.77 |
| logS | -3.25 |
| pKa (Strongest Acidic) | Not Available |
| pKa (Strongest Basic) | -4.23 |
| Hydrogen Acceptor Count | 1 |
| Hydrogen Donor Count | 0 |
| Polar Surface Area | 12.53 Ų |
| Rotatable Bond Count | 0 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 43.41 m³·mol⁻¹ |
| Polarizability | 17.88 |