Showing Metabocard for tetradecanoate (BASm0001774)
| Common Name | Tetradecanoate |
|---|---|
| Description | Tetradecanoate (n-c14:0) belongs to the class of Straight Chain Fatty Acids. These are fatty acids with a straight aliphatic chain. (inferred from compound structure) |
| Structure | |
| Molecular Formula | C14H27O2 |
| Average Mass | 227.36300 |
| Monoisotopic Mass | 227.20111 |
| IUPAC Name | tetradecanoic acid |
| Traditional Name | Myristic acid |
| CAS Registry Number | Not Available |
| SMILES | CCCCCCCCCCCCCC(=O)[O-] |
| InChI Identifier | InChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16)/p-1 |
| InChI Key | TUNFSRHWOTWDNC-UHFFFAOYSA-M |
| CHEBI ID | CHEBI:30807 |
| MiMeDB ID | MMDBc0031674 |
| State | Expected Solid |
| Water Solubility | 1.72e-03 g/l |
| logP | 6.10 |
| logS | -5.12 |
| pKa (Strongest Acidic) | 4.95 |
| pKa (Strongest Basic) | Not Available |
| Hydrogen Acceptor Count | 2 |
| Hydrogen Donor Count | 1 |
| Polar Surface Area | 37.3 Ų |
| Rotatable Bond Count | 12 |
| Physiological Charge | -1 |
| Formal Charge | 0 |
| Refractivity | 67.88 m³·mol⁻¹ |
| Polarizability | 30.10 |