Showing Metabocard for 4-acetoxyphenol (BASm0001801)
| Common Name | 4-acetoxyphenol |
|---|---|
| Description | This compound belongs to the family of Phenol Esters. These are aromatic compounds containing a benzene ring substituted by an hydroxyl group and an ester group. |
| Structure | |
| Molecular Formula | C8H8O3 |
| Average Mass | 152.14730 |
| Monoisotopic Mass | 152.04734 |
| IUPAC Name | 4-hydroxyphenyl acetate |
| Traditional Name | 4-hydroxyphenyl acetate |
| CAS Registry Number | Not Available |
| SMILES | CC(=O)Oc1ccc(O)cc1 |
| InChI Identifier | InChI=1S/C8H8O3/c1-6(9)11-8-4-2-7(10)3-5-8/h2-5,10H,1H3 |
| InChI Key | HBMCQTHGYMTCOF-UHFFFAOYSA-N |
| CHEBI ID | CHEBI:31128 |
| HMDB ID | HMDB0060390 |
| State | Not Available |
| Water Solubility | 3.19e+00 g/l |
| logP | 1.44 |
| logS | -1.68 |
| pKa (Strongest Acidic) | 9.49 |
| pKa (Strongest Basic) | -5.92 |
| Hydrogen Acceptor Count | 2 |
| Hydrogen Donor Count | 1 |
| Polar Surface Area | 46.53 Ų |
| Rotatable Bond Count | 2 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 39.17 m³·mol⁻¹ |
| Polarizability | 15.10 |