Showing Metabocard for 2-methoxy-4-vinylphenol (BASm0002116)
| Common Name | 2-methoxy-4-vinylphenol |
|---|---|
| Description | 2-Methoxy-4-vinylphenol is an aromatic substance used as a flavoring agent. It is one of the compounds responsible for the natural aroma of buckwheat. |
| Structure | |
| Molecular Formula | C9H10O2 |
| Average Mass | 150.17450 |
| Monoisotopic Mass | 150.06808 |
| IUPAC Name | 4-ethenyl-2-methoxyphenol |
| Traditional Name | 2-methoxy-4-vinyl-phenol |
| CAS Registry Number | 7786-61-0 |
| SMILES | C=Cc1ccc(O)c(OC)c1 |
| InChI Identifier | InChI=1S/C9H10O2/c1-3-7-4-5-8(10)9(6-7)11-2/h3-6,10H,1H2,2H3 |
| InChI Key | YOMSJEATGXXYPX-UHFFFAOYSA-N |
| CHEBI ID | CHEBI:42438 |
| HMDB ID | HMDB0013744 |
| State | Not Available |
| Water Solubility | 7.42e+00 g/l |
| logP | 1.84 |
| logS | -1.31 |
| pKa (Strongest Acidic) | 10.03 |
| pKa (Strongest Basic) | -4.89 |
| Hydrogen Acceptor Count | 2 |
| Hydrogen Donor Count | 1 |
| Polar Surface Area | 29.46 Ų |
| Rotatable Bond Count | 2 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 44.19 m³·mol⁻¹ |
| Polarizability | 16.04 |