Showing Metabocard for (6R)-L-erythro-6,7-dihydrobiopterin (BASm0002133)
| Common Name | (6r)-l-erythro-6,7-dihydrobiopterin |
|---|---|
| Description | Carbinolamine 4a-hydroxytetrahydrobiopterin is formed as a consequence of the hydroxylation of phenylalanine to tyrosine. During the physiological reaction tetrahydrobiopterin (the naturally occurring cofactor for phenylalanine hydroxylase), and the two substrates phenylalanine and molecular oxygen combine with phenylalanine hydroxylase to form a quarternary complex. An enzyme, 4a-carbinolamine dehydratase, catalyzes the reaction. (PMID: 2722790 ). |
| Structure | |
| Molecular Formula | C9H13N5O3 |
| Average Mass | 239.23120 |
| Monoisotopic Mass | 239.10184 |
| IUPAC Name | (6R)-2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-1,4,6,7-tetrahydropteridin-4-one |
| Traditional Name | (6r)-2-amino-6-[(1r,2s)-1,2-dihydroxypropyl]-6,7-dihydro-1h-pteridin-4-one |
| CAS Registry Number | 79647-29-3 |
| SMILES | C[C@H](O)[C@H](O)[C@H]1CNC2=NC(N)=NC(=O)C2=N1 |
| InChI Identifier | InChI=1S/C9H13N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h3-4,6,15-16H,2H2,1H3,(H3,10,11,13,14,17)/t3-,4+,6-/m0/s1 |
| InChI Key | ZHQJVZLJDXWFFX-RPDRRWSUSA-N |
| CHEBI ID | CHEBI:43120 |
| HMDB ID | HMDB0002215 |
| State | Not Available |
| Water Solubility | 1.45e+00 g/l |
| logP | -1.41 |
| logS | -2.22 |
| pKa (Strongest Acidic) | 7.69 |
| pKa (Strongest Basic) | 1.82 |
| Hydrogen Acceptor Count | 8 |
| Hydrogen Donor Count | 4 |
| Polar Surface Area | 132.66 Ų |
| Rotatable Bond Count | 2 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 57.03 m³·mol⁻¹ |
| Polarizability | 22.77 |