Showing Metabocard for 13-cis-retinal (BASm0002165)
| Common Name | 13-cis-retinal |
|---|---|
| Description | 13-cis-Retinal is a naturally occurring retinoid. Retinoids are vitamin A analogs that have profound biological activities. Several retinoids have been reported to have antiinflammatory activity in certain animal models of arthritis, such as adjuvant-induced and streptococcal cell wall-induced arthritis in rats. Some retinoids also have been shown to possess antiinftammatory activity in man by their ability to modulate inflammatory diseases of the skin. It has been reported, for example, that retinoid treatment can inhibit neutrophil accumulation in cutaneous disorders such as psoriasis. (PMID:2123476 ). |
| Structure | |
| Molecular Formula | C20H28O |
| Average Mass | 284.43570 |
| Monoisotopic Mass | 284.21402 |
| IUPAC Name | (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenal |
| Traditional Name | 13-cis-retinal |
| CAS Registry Number | 472-86-6 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C\C=O)C(C)(C)CCC1 |
| InChI Identifier | InChI=1S/C20H28O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,15H,7,10,14H2,1-5H3/b9-6+,12-11+,16-8+,17-13- |
| InChI Key | NCYCYZXNIZJOKI-HWCYFHEPSA-N |
| CHEBI ID | CHEBI:45487 |
| HMDB ID | HMDB0006220 |
| State | Solid |
| Water Solubility | 4.20e-03 g/l |
| logP | 6.62 |
| logS | -4.83 |
| pKa (Strongest Acidic) | Not Available |
| pKa (Strongest Basic) | -4.06 |
| Hydrogen Acceptor Count | 1 |
| Hydrogen Donor Count | 0 |
| Polar Surface Area | 17.07 Ų |
| Rotatable Bond Count | 5 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 96.87 m³·mol⁻¹ |
| Polarizability | 35.51 |