Showing Metabocard for 8-oxoguanine (BASm0002471)
| Common Name | 8-oxoguanine |
|---|---|
| Description | Formation of 8-hydroxyguanine (8-OHG), a mutagenic base which is a marker for OH-mediated DNA damage, requires peroxidase and halides and occurs in the presence of transition metal chelators (DTPA +/- desferrioxamine), and is inhibited by catalase, superoxide dismutase (SOD), and scavengers of hypohalous acids. (PMID 10820020 ). 8-Hydroxyguanine is an oxidative stress marker for diagnosis of Alzheimer's disease (AD). (PMID 15977989 ). |
| Structure | |
| Molecular Formula | C5H5N5O2 |
| Average Mass | 167.12550 |
| Monoisotopic Mass | 167.04432 |
| IUPAC Name | 2-amino-6,7,8,9-tetrahydro-1H-purine-6,8-dione |
| Traditional Name | 8-hydroxyguanine |
| CAS Registry Number | 5614-64-2 |
| SMILES | Nc1nc2[nH]c(=O)[nH]c2c(=O)[nH]1 |
| InChI Identifier | InChI=1S/C5H5N5O2/c6-4-8-2-1(3(11)10-4)7-5(12)9-2/h(H5,6,7,8,9,10,11,12) |
| InChI Key | CLGFIVUFZRGQRP-UHFFFAOYSA-N |
| CHEBI ID | CHEBI:52617 |
| HMDB ID | HMDB0002032 |
| State | Solid |
| Water Solubility | 1.94e+00 g/l |
| logP | -1.57 |
| logS | -1.93 |
| pKa (Strongest Acidic) | 7.35 |
| pKa (Strongest Basic) | 3.95 |
| Hydrogen Acceptor Count | 4 |
| Hydrogen Donor Count | 4 |
| Polar Surface Area | 108.61 Ų |
| Rotatable Bond Count | 0 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 47.81 m³·mol⁻¹ |
| Polarizability | 14.26 |