Showing Metabocard for 3-(3-hydroxyphenyl)propanoate (BASm0002550)
| Common Name | 3-(3-hydroxyphenyl)propanoate |
|---|---|
| Description | 3-(3-Hydroxyphenyl)propanoic (hMPP) acid is one of the major metabolites of ingested caffeic acid (PMID: 15479001 ) and of the phenolic degradation products of proanthocyanidins (the most abundant polyphenol present in chocolate) by the microflora in the colon (PMID: 12663291 ). mHPP is suspected to have antioxidants properties and is actively absorbed by the monocarboxylic acid transporter (MCT) in intestinal Caco-2 cell monolayers (PMID: 15479001 , 12663291 ). hMPP has been found to be a metabolite of Clostridium, Escherichia, and Eubacterium (PMID: 28393285 , 19520845 ). 3-(3-Hydroxyphenyl)propanoic acid is a flavonoid metabolite. 3-(3-Hydroxyphenyl)propanoic acid is a phenolic acid metabolite formed by the gut microflora detected after the consumption of whole grain. |
| Structure | |
| Molecular Formula | C9H10O3 |
| Average Mass | 166.17390 |
| Monoisotopic Mass | 166.06299 |
| IUPAC Name | 3-(3-hydroxyphenyl)propanoic acid |
| Traditional Name | Dihydro-3-coumaric acid |
| CAS Registry Number | 621-54-5 |
| SMILES | O=C([O-])CCc1cccc(O)c1 |
| InChI Identifier | InChI=1S/C9H10O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6,10H,4-5H2,(H,11,12) |
| InChI Key | QVWAEZJXDYOKEH-UHFFFAOYSA-N |
| CHEBI ID | CHEBI:57277 |
| HMDB ID | HMDB0000375 |
| State | Not Available |
| Water Solubility | 2.80e+00 g/l |
| logP | 1.14 |
| logS | -1.77 |
| pKa (Strongest Acidic) | 4.21 |
| pKa (Strongest Basic) | -5.96 |
| Hydrogen Acceptor Count | 3 |
| Hydrogen Donor Count | 2 |
| Polar Surface Area | 57.53 Ų |
| Rotatable Bond Count | 3 |
| Physiological Charge | -1 |
| Formal Charge | 0 |
| Refractivity | 43.95 m³·mol⁻¹ |
| Polarizability | 16.92 |