Showing Metabocard for (3S)-3,6-diaminohexanoate (BASm0002693)
| Common Name | (3s)-3,6-diaminohexanoate |
|---|---|
| Description | (r)-beta-lysine belongs to the class of Beta Amino Acids and Derivatives. These are amino acids having a (-NH2) group attached to the beta carbon atom. (inferred from compound structure) β-Lysine (3,6-diaminohexanoic acid) is an amino acid produced by platelets during coagulation and is directly antibacterial by causing lysis of many Gram positive bacteria by acting as a cationic detergent. (WikiPedia) |
| Structure | |
| Molecular Formula | C6H14N2O2 |
| Average Mass | 146.18760 |
| Monoisotopic Mass | 146.10553 |
| IUPAC Name | (3R)-3,6-diaminohexanoic acid |
| Traditional Name | (3r)-3,6-diaminohexanoic acid |
| CAS Registry Number | Not Available |
| SMILES | [NH3+]CCC[C@H]([NH3+])CC(=O)[O-] |
| InChI Identifier | InChI=1S/C6H14N2O2/c7-3-1-2-5(8)4-6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m1/s1 |
| InChI Key | QKEWQOJCHPFEAF-RXMQYKEDSA-N |
| CHEBI ID | CHEBI:57434 |
| State | Not Available |
| Water Solubility | 99.3 g/l |
| logP | -3.56 |
| logS | -0.17 |
| pKa (Strongest Acidic) | Not Available |
| pKa (Strongest Basic) | Not Available |
| Hydrogen Acceptor Count | 4 |
| Hydrogen Donor Count | 3 |
| Polar Surface Area | 89.34 Ų |
| Rotatable Bond Count | 5 |
| Physiological Charge | Not Available |
| Formal Charge | 0 |
| Refractivity | 37.83 m³·mol⁻¹ |
| Polarizability | 15.86 |