Showing Metabocard for N-ethylglycine (BASm0002699)
| Common Name | N-ethylglycine |
|---|---|
| Description | N-Ethylglycine, also known as EG, belongs to the family of compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). N-ethylglyicne is a known metabolite of the anesthesia drug lidocaine (PMID: 25932687 ). N-ethylglyicne is also an endogenously produced metabolite and appears in normal subjects’ urine in small amounts, but its presence is significantly higher in patients with metastatic bone disease (PMID: 16962088 ). Research has shown that it is lidocaine’s metabolites, n-ethylglycine and monoethylglycinexylidide inhibit GlyT1-mediated uptake of glycine. N-ethylglycine acts as a substrate for the glycine transporter GlyT1 (PMID: 22133759 , 25932687 ). |
| Structure | |
| Molecular Formula | C4H9NO2 |
| Average Mass | 103.11980 |
| Monoisotopic Mass | 103.06333 |
| IUPAC Name | 2-(ethylamino)acetic acid |
| Traditional Name | N-ethylglycine |
| CAS Registry Number | 627-01-0 |
| SMILES | CC[NH2+]CC(=O)[O-] |
| InChI Identifier | InChI=1S/C4H9NO2/c1-2-5-3-4(6)7/h5H,2-3H2,1H3,(H,6,7) |
| InChI Key | YPIGGYHFMKJNKV-UHFFFAOYSA-N |
| CHEBI ID | CHEBI:57440 |
| HMDB ID | HMDB0041945 |
| State | Not Available |
| Water Solubility | 2.63e+02 g/l |
| logP | -2.52 |
| logS | 0.41 |
| pKa (Strongest Acidic) | 2.20 |
| pKa (Strongest Basic) | 10.43 |
| Hydrogen Acceptor Count | 3 |
| Hydrogen Donor Count | 2 |
| Polar Surface Area | 49.33 Ų |
| Rotatable Bond Count | 3 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 25.53 m³·mol⁻¹ |
| Polarizability | 10.65 |