Showing Metabocard for alpha-maltose 6'-phosphate (BASm0002734)
| Common Name | Alpha-maltose 6'-phosphate |
|---|---|
| Description | Maltose 6'-phosphate is a member of the chemical class known as Dihexoses. These are disaccharides containing two hexose carbohydrates. |
| Structure | |
| Molecular Formula | C12H23O14P |
| Average Mass | 422.27640 |
| Monoisotopic Mass | 422.08254 |
| IUPAC Name | {[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-{[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxan-2-yl]methoxy}phosphonic acid |
| Traditional Name | [(2r,3s,4s,5r,6r)-3,4,5-trihydroxy-6-{[(2r,3s,4r,5r,6s)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxan-2-yl]methoxyphosphonic acid |
| CAS Registry Number | Not Available |
| SMILES | O=P([O-])([O-])OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI Identifier | InChI=1S/C12H23O14P/c13-1-3-10(7(16)8(17)11(19)24-3)26-12-9(18)6(15)5(14)4(25-12)2-23-27(20,21)22/h3-19H,1-2H2,(H2,20,21,22)/t3-,4-,5-,6+,7-,8-,9-,10-,11+,12-/m1/s1 |
| InChI Key | ITPHOIFCAFNCLL-ASMJPISFSA-N |
| CHEBI ID | CHEBI:57478 |
| State | Not Available |
| Water Solubility | 4.07e+01 g/l |
| logP | -2.42 |
| logS | -1.02 |
| pKa (Strongest Acidic) | Not Available |
| pKa (Strongest Basic) | Not Available |
| Hydrogen Acceptor Count | 13 |
| Hydrogen Donor Count | 9 |
| Polar Surface Area | 236.06 Ų |
| Rotatable Bond Count | 6 |
| Physiological Charge | Not Available |
| Formal Charge | 0 |
| Refractivity | 79.21 m³·mol⁻¹ |
| Polarizability | 35.37 |