Showing Metabocard for N-acetyl-D-glucosamine 6-phosphate (BASm0002762)
Common Name | N-acetyl-d-glucosamine 6-phosphate |
---|---|
Description | N-Acetyl-D-Glucosamine 6-Phosphate is an intermediate in the metabolism of Aminosugars. It is a substrate for Glucosamine 6-phosphate N-acetyltransferase. |
Structure | |
Molecular Formula | C8H16NO9P |
Average Mass | 301.18770 |
Monoisotopic Mass | 301.05627 |
IUPAC Name | {[(2R,3S,4R,5R)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methoxy}phosphonic acid |
Traditional Name | [(2r,3s,4r,5r)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methoxyphosphonic acid |
CAS Registry Number | 18191-20-3 |
SMILES | CC(=O)N[C@H]1C(O)O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@@H]1O |
InChI Identifier | InChI=1S/C8H16NO9P/c1-3(10)9-5-7(12)6(11)4(18-8(5)13)2-17-19(14,15)16/h4-8,11-13H,2H2,1H3,(H,9,10)(H2,14,15,16)/t4-,5-,6-,7-,8?/m1/s1 |
InChI Key | BRGMHAYQAZFZDJ-RTRLPJTCSA-N |
CHEBI ID | CHEBI:57513 |
HMDB ID | HMDB0001062 |
Pathways | |
State | Solid |
Water Solubility | 1.76e+01 g/l |
logP | -2.02 |
logS | -1.23 |
pKa (Strongest Acidic) | 1.23 |
pKa (Strongest Basic) | -0.79 |
Hydrogen Acceptor Count | 8 |
Hydrogen Donor Count | 6 |
Polar Surface Area | 165.78 Ų |
Rotatable Bond Count | 4 |
Physiological Charge | -2 |
Formal Charge | 0 |
Refractivity | 57.90 m³·mol⁻¹ |
Polarizability | 25.80 |