Showing Metabocard for 4-phospho-L-aspartate (BASm0002777)
| Common Name | 4-phospho-l-aspartate |
|---|---|
| Description | L-Aspartyl-4-phosphate belongs to the class of organic compounds known as aspartic acid and derivatives. Aspartic acid and derivatives are compounds containing an aspartic acid or a derivative thereof resulting from a reaction of aspartic acid at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. L-Aspartyl-4-phosphate is a very strong basic compound (based on its pKa). L-Aspartyl-4-phosphate is involved in both the lysine biosynthesis I and homoserine biosynthesis pathways. L-Aspartyl-4-phosphate is produced from a reaction between L-aspartate and ATP, with ADP as a byproduct. The reaction is catalyzed by aspartate kinase. L-Aspartyl-4-phosphate reacts with NADPH to produce phosphate, L-aspartate-semialdehyde, and NADP+. Aspartate-semialdehyde dehydrogenase catalyzes this reaction. |
| Structure | |
| Molecular Formula | C4H8NO7P |
| Average Mass | 213.08260 |
| Monoisotopic Mass | 213.00384 |
| IUPAC Name | 2-amino-4-oxo-4-(phosphonooxy)butanoic acid |
| Traditional Name | 2-amino-4-oxo-4-(phosphonooxy)butanoic acid |
| CAS Registry Number | 22138-53-0 |
| SMILES | [NH3+][C@@H](CC(=O)OP(=O)([O-])[O-])C(=O)[O-] |
| InChI Identifier | InChI=1S/C4H8NO7P/c5-2(4(7)8)1-3(6)12-13(9,10)11/h2H,1,5H2,(H,7,8)(H2,9,10,11)/t2-/m0/s1 |
| InChI Key | IXZNKTPIYKDIGG-REOHCLBHSA-N |
| CHEBI ID | CHEBI:57535 |
| HMDB ID | HMDB0012250 |
| State | Solid |
| Water Solubility | 1.32e+01 g/l |
| logP | -1.91 |
| logS | -1.21 |
| pKa (Strongest Acidic) | 1.08 |
| pKa (Strongest Basic) | 8.60 |
| Hydrogen Acceptor Count | 7 |
| Hydrogen Donor Count | 4 |
| Polar Surface Area | 147.15 Ų |
| Rotatable Bond Count | 5 |
| Physiological Charge | -2 |
| Formal Charge | 0 |
| Refractivity | 37.69 m³·mol⁻¹ |
| Polarizability | 16.08 |