Showing Metabocard for O-phospho-L-homoserine (BASm0002816)
| Common Name | O-phospho-l-homoserine |
|---|---|
| Description | O-phosphohomoserine is a naturally occurring analogue of phosphonate amino acids. O-phosphohomoserine has been found in trace amounts in shotgun-metabolomics analysis in mouse tissue extracts, and is the substrate of a threonine analog enzyme in murine species. O-phosphohomoserine, an analogue of the excitatory amino acid antagonist 2-amino-phosphonovalerate is an N-methyl-D-aspartate (NMDA) antagonist. (PMID: 3528930 , 17034760 , 17665876 ). |
| Structure | |
| Molecular Formula | C4H10NO6P |
| Average Mass | 199.09910 |
| Monoisotopic Mass | 199.02457 |
| IUPAC Name | (2S)-2-amino-4-(phosphonooxy)butanoic acid |
| Traditional Name | O-phosphohomoserine |
| CAS Registry Number | 4210-66-6 |
| SMILES | [NH3+][C@@H](CCOP(=O)([O-])[O-])C(=O)[O-] |
| InChI Identifier | InChI=1S/C4H10NO6P/c5-3(4(6)7)1-2-11-12(8,9)10/h3H,1-2,5H2,(H,6,7)(H2,8,9,10)/t3-/m0/s1 |
| InChI Key | FXDNYOANAXWZHG-VKHMYHEASA-N |
| CHEBI ID | CHEBI:57590 |
| HMDB ID | HMDB0003484 |
| State | Solid |
| Water Solubility | 1.81e+01 g/l |
| logP | -2.34 |
| logS | -1.04 |
| pKa (Strongest Acidic) | 1.52 |
| pKa (Strongest Basic) | 9.46 |
| Hydrogen Acceptor Count | 6 |
| Hydrogen Donor Count | 4 |
| Polar Surface Area | 130.08 Ų |
| Rotatable Bond Count | 5 |
| Physiological Charge | -2 |
| Formal Charge | 0 |
| Refractivity | 37.78 m³·mol⁻¹ |
| Polarizability | 15.86 |