Showing Metabocard for (2S,6S)-2,6-diaminoheptanedioate (BASm0002830)
| Common Name | (2s,6s)-2,6-diaminoheptanedioate |
|---|---|
| Description | Diaminopimelic acid or DAPA is a lysine-like amino acid derivative that is a key component of the bacterial cell wall. DAPA is incorporated or integrated into peptidoglycan of gram negative bacteria and is the attachment point for Braun's lipoprotein (BLP or Murein Lipoprotein). BLP is found in gram-negative cell walls and is one of the most abundant membrane proteins. BLP is bound at its C-terminal end (a lysine) by a covalent bond to the peptidoglycan layer (specifically to diaminopimelic acid molecules) and is embedded in the outer membrane by its hydrophobic head (a cysteine with lipids attached). BLP tightly links the two layers and provides structural integrity to the bacterial outer membrane. Diaminopimelic acid can be found in human urine or feces due to the lysis or enzymatic breakdown of gram negative gut microbes. |
| Structure | |
| Molecular Formula | C7H14N2O4 |
| Average Mass | 190.19710 |
| Monoisotopic Mass | 190.09536 |
| IUPAC Name | (2S,6S)-2,6-diaminoheptanedioic acid |
| Traditional Name | 2,6-diaminopimelic acid |
| CAS Registry Number | 583-93-7 |
| SMILES | [NH3+][C@@H](CCC[C@H]([NH3+])C(=O)[O-])C(=O)[O-] |
| InChI Identifier | InChI=1S/C7H14N2O4/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5-/m0/s1 |
| InChI Key | GMKMEZVLHJARHF-WHFBIAKZSA-N |
| CHEBI ID | CHEBI:57609 |
| HMDB ID | HMDB0001370 |
| State | Solid |
| Water Solubility | 1.41e+01 g/l |
| logP | -4.13 |
| logS | -1.13 |
| pKa (Strongest Acidic) | 1.85 |
| pKa (Strongest Basic) | 9.83 |
| Hydrogen Acceptor Count | 6 |
| Hydrogen Donor Count | 4 |
| Polar Surface Area | 126.64 Ų |
| Rotatable Bond Count | 6 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 43.64 m³·mol⁻¹ |
| Polarizability | 18.63 |