Showing Metabocard for dimethylallyl diphosphate (BASm0002835)
Common Name | Dimethylallyl diphosphate |
---|---|
Description | Dimethylallylpyrophosphate, also known as 2-isopentenyl diphosphate or delta-prenyl diphosphoric acid, belongs to the class of organic compounds known as isoprenoid phosphates. These are prenol lipids containing a phosphate group linked to an isoprene (2-methylbuta-1,3-diene) unit. Dimethylallylpyrophosphate is a very hydrophobic molecule, practically insoluble in water, and relatively neutral. |
Structure | |
Molecular Formula | C5H12O7P2 |
Average Mass | 246.09210 |
Monoisotopic Mass | 246.00583 |
IUPAC Name | ({hydroxy[(3-methylbut-2-en-1-yl)oxy]phosphoryl}oxy)phosphonic acid |
Traditional Name | [hydroxy(3-methylbut-2-en-1-yl)oxyphosphoryl]oxyphosphonic acid |
CAS Registry Number | 358-72-5 |
SMILES | CC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-] |
InChI Identifier | InChI=1S/C5H12O7P2/c1-5(2)3-4-11-14(9,10)12-13(6,7)8/h3H,4H2,1-2H3,(H,9,10)(H2,6,7,8) |
InChI Key | CBIDRCWHNCKSTO-UHFFFAOYSA-N |
CHEBI ID | CHEBI:57623 |
HMDB ID | HMDB0001120 |
Pathways | |
State | Solid |
Water Solubility | 6.54e+00 g/l |
logP | 0.30 |
logS | -1.58 |
pKa (Strongest Acidic) | 1.77 |
pKa (Strongest Basic) | Not Available |
Hydrogen Acceptor Count | 5 |
Hydrogen Donor Count | 3 |
Polar Surface Area | 113.29 Ų |
Rotatable Bond Count | 5 |
Physiological Charge | -2 |
Formal Charge | 0 |
Refractivity | 49.13 m³·mol⁻¹ |
Polarizability | 19.33 |