Showing Metabocard for 2-(3,4-dihydroxybenzoyloxy)-4,6-dihydroxybenzoate (BASm0002838)
| Common Name | 2-(3,4-dihydroxybenzoyloxy)-4,6-dihydroxybenzoate |
|---|---|
| Description | 2-(3,4-dihydroxybenzoyloxy)-4,6-dihydroxybenzoate is an intermediate in the degradation of quercetin by E. coli. Quercetin is a flavonoid widely distributed in many plants and fruits including red grapes, citrus fruit, tomato, broccoli and other leafy green vegetables, and a number of berries, including raspberries and cranberries. In E. coli it is metabolized by Quercetin 2,3-dioxygenase. This enzyme catalyzes the reaction Quercetin + O2 = 2-(3,4-dihydroxybenzoyloxy)-4,6-dihydroxybenzoate + CO + H+. Quercetin is not a normal growth substrate for E. coli but it is found in high levels in the human gut. This enzyme may have evolved to break down quercitin to prevent its inhibition of key E. coli proteins, such as DNA gyrase. |
| Structure | |
| Molecular Formula | C14H10O8 |
| Average Mass | 306.22440 |
| Monoisotopic Mass | 306.03757 |
| IUPAC Name | 2-[(3,4-dihydroxyphenyl)carbonyloxy]-4,6-dihydroxybenzoic acid |
| Traditional Name | 2-[(3,4-dihydroxyphenyl)carbonyloxy]-4,6-dihydroxybenzoic acid |
| CAS Registry Number | Not Available |
| SMILES | O=C(Oc1cc(O)cc(O)c1C(=O)[O-])c1ccc(O)c(O)c1 |
| InChI Identifier | InChI=1S/C14H10O8/c15-7-4-10(18)12(13(19)20)11(5-7)22-14(21)6-1-2-8(16)9(17)3-6/h1-5,15-18H,(H,19,20) |
| InChI Key | GRXIELRCPYIEQI-UHFFFAOYSA-N |
| CHEBI ID | CHEBI:57628 |
| State | Not Available |
| Water Solubility | 2.31e-01 g/l |
| logP | 2.47 |
| logS | -3.12 |
| pKa (Strongest Acidic) | Not Available |
| pKa (Strongest Basic) | Not Available |
| Hydrogen Acceptor Count | 7 |
| Hydrogen Donor Count | 5 |
| Polar Surface Area | 144.52 Ų |
| Rotatable Bond Count | 4 |
| Physiological Charge | Not Available |
| Formal Charge | 0 |
| Refractivity | 73.04 m³·mol⁻¹ |
| Polarizability | 27.89 |