Showing Metabocard for cis-4-hydroxy-D-proline (BASm0002888)
| Common Name | Cis-4-hydroxy-d-proline |
|---|---|
| Description | cis-4-Hydroxy-D-proline belongs to the class of organic compounds known as proline and derivatives. Proline and derivatives are compounds containing proline or a derivative thereof resulting from a reaction of proline at the amino group or the carboxyl group, or from the replacement of any hydrogen of glycine by a heteroatom. |
| Structure | |
| Molecular Formula | C5H9NO3 |
| Average Mass | 131.12990 |
| Monoisotopic Mass | 131.05824 |
| IUPAC Name | (2R,4R)-4-hydroxypyrrolidine-2-carboxylic acid |
| Traditional Name | Cis-4-hydroxy-d-proline |
| CAS Registry Number | 2584-71-6 |
| SMILES | O=C([O-])[C@H]1C[C@@H](O)C[NH2+]1 |
| InChI Identifier | InChI=1S/C5H9NO3/c7-3-1-4(5(8)9)6-2-3/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4-/m1/s1 |
| InChI Key | PMMYEEVYMWASQN-QWWZWVQMSA-N |
| CHEBI ID | CHEBI:57690 |
| HMDB ID | HMDB0060460 |
| State | Not Available |
| Water Solubility | 4.92e+02 g/l |
| logP | -3.31 |
| logS | 0.57 |
| pKa (Strongest Acidic) | 1.64 |
| pKa (Strongest Basic) | 10.62 |
| Hydrogen Acceptor Count | 4 |
| Hydrogen Donor Count | 3 |
| Polar Surface Area | 69.56 Ų |
| Rotatable Bond Count | 1 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 29.38 m³·mol⁻¹ |
| Polarizability | 12.34 |