Showing Metabocard for D-proline (BASm0002915)
Common Name | D-proline |
---|---|
Description | D-proline is an isomer of the naturally occurring amino acid, L-Proline. D-amino acids have been found in relatively high abundance in human plasma and saliva (PMID: 16480744 ). These amino acids may be of bacterial origin, but there is also evidence that they are endogenously produced through amino acid racemase activity (PMID: 1426150 ). |
Structure | |
Molecular Formula | C5H9NO2 |
Average Mass | 115.13050 |
Monoisotopic Mass | 115.06333 |
IUPAC Name | (2R)-pyrrolidine-2-carboxylic acid |
Traditional Name | D-proline |
CAS Registry Number | 344-25-2 |
SMILES | O=C([O-])[C@H]1CCC[NH2+]1 |
InChI Identifier | InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m1/s1 |
InChI Key | ONIBWKKTOPOVIA-SCSAIBSYSA-N |
CHEBI ID | CHEBI:57726 |
HMDB ID | HMDB0003411 |
Pathways | |
State | Solid |
Water Solubility | 3.65e+02 g/l |
logP | -2.71 |
logS | 0.50 |
pKa (Strongest Acidic) | 1.94 |
pKa (Strongest Basic) | 11.33 |
Hydrogen Acceptor Count | 3 |
Hydrogen Donor Count | 2 |
Polar Surface Area | 49.33 Ų |
Rotatable Bond Count | 1 |
Physiological Charge | 0 |
Formal Charge | 0 |
Refractivity | 28.06 m³·mol⁻¹ |
Polarizability | 11.39 |