Showing Metabocard for 2-oxosuccinamate (BASm0002923)
| Common Name | 2-oxosuccinamate |
|---|---|
| Description | This compound belongs to the family of Short-chain Keto Acids and Derivatives. These are keto acids with an alkyl chain the contains less than 6 carbon atoms |
| Structure | |
| Molecular Formula | C4H5NO4 |
| Average Mass | 131.08680 |
| Monoisotopic Mass | 131.02186 |
| IUPAC Name | 3-(C-hydroxycarbonimidoyl)-2-oxopropanoic acid |
| Traditional Name | Oxaloacetamide |
| CAS Registry Number | Not Available |
| SMILES | NC(=O)CC(=O)C(=O)[O-] |
| InChI Identifier | InChI=1S/C4H5NO4/c5-3(7)1-2(6)4(8)9/h1H2,(H2,5,7)(H,8,9) |
| InChI Key | ONGPAWNLFDCRJE-UHFFFAOYSA-N |
| CHEBI ID | CHEBI:57735 |
| HMDB ID | HMDB0060350 |
| State | Not Available |
| Water Solubility | 5.02e+00 g/l |
| logP | -1.26 |
| logS | -1.42 |
| pKa (Strongest Acidic) | 2.48 |
| pKa (Strongest Basic) | 7.29 |
| Hydrogen Acceptor Count | 5 |
| Hydrogen Donor Count | 3 |
| Polar Surface Area | 98.45 Ų |
| Rotatable Bond Count | 3 |
| Physiological Charge | -1 |
| Formal Charge | 0 |
| Refractivity | 37.09 m³·mol⁻¹ |
| Polarizability | 10.52 |