Showing Metabocard for meso-2,6-diaminoheptanedioate (BASm0002963)
| Common Name | Meso-2,6-diaminoheptanedioate |
|---|---|
| Description | Meso-2,6-diaminoheptanedioate is a member of the chemical class known as Alpha Amino Acids and Derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). This particular compound is at a branch point in lysine biosynthesis where it is either the penultimate step in lysine biosynthesis in E. coli (via diaminopimelate decarboxylase, LysA) or it can be directed towards the synthesis of peptidoglycan (via murE). |
| Structure | |
| Molecular Formula | C7H14N2O4 |
| Average Mass | 190.19710 |
| Monoisotopic Mass | 190.09536 |
| IUPAC Name | (2S,6S)-2,6-diaminoheptanedioic acid |
| Traditional Name | 2,6-diaminopimelic acid |
| CAS Registry Number | 922-54-3 |
| SMILES | [NH3+][C@H](CCC[C@H]([NH3+])C(=O)[O-])C(=O)[O-] |
| InChI Identifier | InChI=1S/C7H14N2O4/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5+ |
| InChI Key | GMKMEZVLHJARHF-SYDPRGILSA-N |
| CHEBI ID | CHEBI:57791 |
| MiMeDB ID | MMDBc0031728 |
| State | Expected Solid |
| Water Solubility | 1.41e+01 g/l |
| logP | -4.13 |
| logS | -1.13 |
| pKa (Strongest Acidic) | 1.85 |
| pKa (Strongest Basic) | 9.83 |
| Hydrogen Acceptor Count | 6 |
| Hydrogen Donor Count | 4 |
| Polar Surface Area | 126.64 Ų |
| Rotatable Bond Count | 6 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 43.64 m³·mol⁻¹ |
| Polarizability | 18.63 |