Showing Metabocard for D-alanyl-D-alanine (BASm0002982)
| Common Name | D-alanyl-d-alanine |
|---|---|
| Description | The ATP-dependent carboxylate-amine/thiol ligase superfamily is known to contain enzymes catalyzing the formation of various types of peptide, one of which is d-alanyl-d-alanine.(PMID: 16030213 ). The glycopeptide antibiotic vancomycin acts by binding to the D-alanyl-D-alanine terminus of the cell wall precursor lipid II in the cytoplasmic membrane.(PMID: 17418637 ). D-alanine-D-alanine ligase from Thermotoga maritima ATCC 43589 (TmDdl) was a useful biocatalyst for synthesizing D-amino acid dipeptides.D-Alanine-D-alanine ligase (Ddl) catalyzes the biosynthesis of an essential bacterial peptidoglycan precursor D-alanyl-D-alanine and it represents an important target for development of new antibacterial drugs. (PMID: 17267218 ). D-Alanyl-D-alanine is a microbial metabolite. |
| Structure | |
| Molecular Formula | C6H12N2O3 |
| Average Mass | 160.17110 |
| Monoisotopic Mass | 160.08479 |
| IUPAC Name | (2R)-2-[(2R)-2-aminopropanamido]propanoic acid |
| Traditional Name | D-ala-d-ala |
| CAS Registry Number | 923-16-0 |
| SMILES | C[C@@H]([NH3+])C(=O)N[C@H](C)C(=O)[O-] |
| InChI Identifier | InChI=1S/C6H12N2O3/c1-3(7)5(9)8-4(2)6(10)11/h3-4H,7H2,1-2H3,(H,8,9)(H,10,11)/t3-,4-/m1/s1 |
| InChI Key | DEFJQIDDEAULHB-QWWZWVQMSA-N |
| CHEBI ID | CHEBI:57822 |
| HMDB ID | HMDB0003459 |
| State | Solid |
| Water Solubility | 7.07e+01 g/l |
| logP | -2.64 |
| logS | -0.36 |
| pKa (Strongest Acidic) | 3.73 |
| pKa (Strongest Basic) | 8.39 |
| Hydrogen Acceptor Count | 4 |
| Hydrogen Donor Count | 3 |
| Polar Surface Area | 92.42 Ų |
| Rotatable Bond Count | 3 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 37.79 m³·mol⁻¹ |
| Polarizability | 15.66 |