Showing Metabocard for N-acetyl-L-glutamyl 5-phosphate (BASm0003074)
| Common Name | N-acetyl-l-glutamyl 5-phosphate |
|---|---|
| Description | N-Acetyl-5-glutamyl phosphate is an intermediate in arginine biosynthesis. It is a substrate for the enzyme N-acetyl-gamma-glutamyl-phosphate reductase which catalyzes the reaction N-acetyl-L-glutamate 5-semialdehyde + NADP+ + phosphate = N-acetyl-5-glutamyl phosphate + NADPH |
| Structure | |
| Molecular Formula | C7H12NO8P |
| Average Mass | 269.14580 |
| Monoisotopic Mass | 269.03005 |
| IUPAC Name | 2-[(1-hydroxyethylidene)amino]-5-oxo-5-(phosphonooxy)pentanoic acid |
| Traditional Name | 2-[(1-hydroxyethylidene)amino]-5-oxo-5-(phosphonooxy)pentanoic acid |
| CAS Registry Number | 15383-57-0 |
| SMILES | CC(=O)N[C@@H](CCC(=O)OP(=O)([O-])[O-])C(=O)[O-] |
| InChI Identifier | InChI=1S/C7H12NO8P/c1-4(9)8-5(7(11)12)2-3-6(10)16-17(13,14)15/h5H,2-3H2,1H3,(H,8,9)(H,11,12)(H2,13,14,15) |
| InChI Key | FCVIHFVSXHOPSW-UHFFFAOYSA-N |
| CHEBI ID | CHEBI:57936 |
| HMDB ID | HMDB06456 |
| State | Solid |
| Water Solubility | 5.15e+00 g/l |
| logP | -2.08 |
| logS | -1.72 |
| pKa (Strongest Acidic) | Not Available |
| pKa (Strongest Basic) | Not Available |
| Hydrogen Acceptor Count | 8 |
| Hydrogen Donor Count | 4 |
| Polar Surface Area | 153.72 Ų |
| Rotatable Bond Count | 7 |
| Physiological Charge | Not Available |
| Formal Charge | 0 |
| Refractivity | 52.41 m³·mol⁻¹ |
| Polarizability | 22.14 |