Showing Metabocard for ADP-D-ribose (BASm0003094)
| Common Name | Adp-d-ribose |
|---|---|
| Description | Adenosine diphosphate ribose is a molecule formed into poly(ADP-ribose) or PAR chains by the enzyme poly ADP ribose polymerase or PARP. PARP is found in every cell nucleus. Its main role is to detect and signal single-strand DNA breaks (SSB) to the enzymatic machinery involved in the SSB repair. PARP activation is an immediate cellular response to metabolic, chemical, or radiation-induced DNA SSB damage. Once PARP detects a SSB, it binds to the DNA, and, after a structural change, begins the synthesis of a poly (ADP-ribose) chain (PAR) as a signal for the other DNA-repairing enzymes such as DNA ligase III (LigIII), DNA polymerase beta, and scaffolding proteins such as X-ray cross-complementing gene 1 (XRCC1). After repairing, the PAR chains are degraded via PAR glycohydrolase (PARG). ADP-ribose binds to and activates the TRPM2 ion channel. Adenosine diphosphate ribose is an intermediate in NAD metabolism. The enzyme NAD(P)+ nucleosidase [EC:3.2.2.6] catalyzes the production of this metabolite from nicotinamide adenine dinucleotide phosphate. This reaction is irreversible and occurs in the cytosol. |
| Structure | |
| Molecular Formula | C15H23N5O14P2 |
| Average Mass | 559.31570 |
| Monoisotopic Mass | 559.07167 |
| IUPAC Name | {[5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}({hydroxy[(3,4,5-trihydroxyoxolan-2-yl)methoxy]phosphoryl}oxy)phosphinic acid |
| Traditional Name | [5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy[hydroxy(3,4,5-trihydroxyoxolan-2-yl)methoxyphosphoryl]oxyphosphinic acid |
| CAS Registry Number | 20762-30-5 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])OC[C@H]2OC(O)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O |
| InChI Identifier | InChI=1S/C15H23N5O14P2/c16-12-7-13(18-3-17-12)20(4-19-7)14-10(23)8(21)5(32-14)1-30-35(26,27)34-36(28,29)31-2-6-9(22)11(24)15(25)33-6/h3-6,8-11,14-15,21-25H,1-2H2,(H,26,27)(H,28,29)(H2,16,17,18) |
| InChI Key | SRNWOUGRCWSEMX-UHFFFAOYSA-N |
| CHEBI ID | CHEBI:57967 |
| HMDB ID | HMDB0001178 |
| Pathways | |
| State | Solid |
| Water Solubility | 3.61e+00 g/l |
| logP | -1.80 |
| logS | -2.19 |
| pKa (Strongest Acidic) | 1.86 |
| pKa (Strongest Basic) | 5.00 |
| Hydrogen Acceptor Count | 15 |
| Hydrogen Donor Count | 8 |
| Polar Surface Area | 291.52 Ų |
| Rotatable Bond Count | 9 |
| Physiological Charge | -2 |
| Formal Charge | 0 |
| Refractivity | 111.12 m³·mol⁻¹ |
| Polarizability | 46.75 |