Showing Metabocard for gamma-L-glutamyl-L-cysteine (BASm0003254)
Common Name | Gamma-l-glutamyl-l-cysteine |
---|---|
Description | gamma-Glutamylcysteine is a dipeptide composed of gamma-glutamate and cysteine, and is a proteolytic breakdown product of larger proteins. It belongs to the family of N-acyl-alpha amino acids and derivatives. These are compounds containing an alpha amino acid which bears an acyl group at its terminal nitrogen atom. gamma-Glutamylcysteine is an incomplete breakdown product of protein digestion or protein catabolism. Some dipeptides are known to have physiological or cell-signaling effects although most are simply short-lived intermediates on their way to specific amino acid degradation pathways following further proteolysis. gamma-Glutamylcysteine is a product of enzyme glutamate-cysteine ligase [EC 6.3.2.2] and a substrate of enzyme glutathione synthase [EC 6.3.2.3] in the glutamate metabolism pathway (KEGG). |
Structure | |
Molecular Formula | C8H14N2O5S |
Average Mass | 250.27200 |
Monoisotopic Mass | 250.06234 |
IUPAC Name | (2S)-2-amino-4-{[(1R)-1-carboxy-2-sulfanylethyl]carbamoyl}butanoic acid |
Traditional Name | Glu(-cys) |
CAS Registry Number | 636-58-8 |
SMILES | [NH3+][C@@H](CCC(=O)N[C@@H](CS)C(=O)[O-])C(=O)[O-] |
InChI Identifier | InChI=1S/C8H14N2O5S/c9-4(7(12)13)1-2-6(11)10-5(3-16)8(14)15/h4-5,16H,1-3,9H2,(H,10,11)(H,12,13)(H,14,15)/t4-,5-/m0/s1 |
InChI Key | RITKHVBHSGLULN-WHFBIAKZSA-N |
CHEBI ID | CHEBI:58173 |
HMDB ID | HMDB0001049 |
Pathways | |
State | Solid |
Water Solubility | 2.62e+00 g/l |
logP | -2.53 |
logS | -1.98 |
pKa (Strongest Acidic) | 1.91 |
pKa (Strongest Basic) | 9.24 |
Hydrogen Acceptor Count | 6 |
Hydrogen Donor Count | 5 |
Polar Surface Area | 129.72 Ų |
Rotatable Bond Count | 7 |
Physiological Charge | -1 |
Formal Charge | 0 |
Refractivity | 56.31 m³·mol⁻¹ |
Polarizability | 23.36 |