Showing Metabocard for 6-amino-2-oxohexanoate (BASm0003264)
| Common Name | 6-amino-2-oxohexanoate |
|---|---|
| Description | 2-Keto-6-aminocaproate is an intermediate in lysine degradation and can be formed from L-lysine. L-Lysine is an essential amino-acid that is a necessary building block for all protein in the body. L-Lysine plays a major role in calcium absorption; building muscle protein; recovering from surgery or sports injuries; and the body's production of hormones, enzymes, and antibodies. L-Lysine can be converted to 2-keto-6-aminocaproate via the enzyme L-lysine alpha-oxidase. 2-Keto-6-aminocaproate can spontaneously decarboxylate to 5-aminovalerate in the presence of the reaction product, hydrogen peroxide. It can also be spontaneously converted in solution to its cyclic form delta-piperideine-2-carboxylate. This has been demonstrated in vitro in the presence of catalase, which splits hydrogen peroxide. |
| Structure | |
| Molecular Formula | C6H11NO3 |
| Average Mass | 145.15640 |
| Monoisotopic Mass | 145.07389 |
| IUPAC Name | 6-amino-2-oxohexanoic acid |
| Traditional Name | 6-amino-2-oxohexanoic acid |
| CAS Registry Number | Not Available |
| SMILES | [NH3+]CCCCC(=O)C(=O)[O-] |
| InChI Identifier | InChI=1S/C6H11NO3/c7-4-2-1-3-5(8)6(9)10/h1-4,7H2,(H,9,10) |
| InChI Key | GWENQMVPLJAMAE-UHFFFAOYSA-N |
| CHEBI ID | CHEBI:58183 |
| HMDB ID | HMDB0012151 |
| State | Solid |
| Water Solubility | 1.71e+01 g/l |
| logP | -2.26 |
| logS | -0.93 |
| pKa (Strongest Acidic) | 3.24 |
| pKa (Strongest Basic) | 10.01 |
| Hydrogen Acceptor Count | 4 |
| Hydrogen Donor Count | 2 |
| Polar Surface Area | 80.39 Ų |
| Rotatable Bond Count | 5 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 35.40 m³·mol⁻¹ |
| Polarizability | 14.62 |