Showing Metabocard for L-glutamyl 5-phosphate (BASm0003335)
| Common Name | L-glutamyl 5-phosphate |
|---|---|
| Description | gamma-L-Glutamyl 5-phosphate is an intermediate in L-proline biosynthesis I pathway in E.coli. It is a product for the enzyme gamma-glutamyl kinase which catalyzes the reaction L-glutamate + ATP -> gamma-L-glutamyl 5-phosphate + ADP. It is also the substrate for the enzyme glutamate-5-semialdehyde dehydrogenase which catalyzes the reaction gamma-L-glutamyl 5-phosphate + NADPH + H+ -> L-glutamate-5-semialdehyde + NADP+ + phosphate (BioCyc compound: L-GLUTAMATE-5-P). |
| Structure | |
| Molecular Formula | C5H8NO7P |
| Average Mass | 225.09400 |
| Monoisotopic Mass | 225.00494 |
| IUPAC Name | (2S)-2-amino-5-oxo-5-(phosphonooxy)pentanoic acid |
| Traditional Name | L-glutam-5-yl phosphate |
| CAS Registry Number | Not Available |
| SMILES | [NH3+][C@@H](CCC(=O)OP(=O)([O-])[O-])C(=O)[O-] |
| InChI Identifier | InChI=1S/C5H10NO7P/c6-3(5(8)9)1-2-4(7)13-14(10,11)12/h3H,1-2,6H2,(H,8,9)(H2,10,11,12)/p-2/t3-/m0/s1 |
| InChI Key | PJRXVIJAERNUIP-VKHMYHEASA-L |
| CHEBI ID | CHEBI:58274 |
| MiMeDB ID | MMDBc0032118 |
| State | Expected Solid |
| Water Solubility | 1.09e+01 g/l |
| logP | -1.96 |
| logS | -1.32 |
| pKa (Strongest Acidic) | 1.12 |
| pKa (Strongest Basic) | 9.51 |
| Hydrogen Acceptor Count | 7 |
| Hydrogen Donor Count | 4 |
| Polar Surface Area | 147.15 Ų |
| Rotatable Bond Count | 6 |
| Physiological Charge | -2 |
| Formal Charge | 0 |
| Refractivity | 42.45 m³·mol⁻¹ |
| Polarizability | 18.09 |