Showing Metabocard for sirohydrochlorin (BASm0003390)
| Common Name | Sirohydrochlorin |
|---|---|
| Description | Sirohydrochlorin is a member of the chemical class known as Precorrins. These are intermediates formed by methylation at one or more of the four rings prior to the formation of the macrocyclic corrin ring. typhimurium, precorrin-2 is a precursor of both siroheme and B12. (PMID 8955319 ) |
| Structure | |
| Molecular Formula | C42H46N4O16 |
| Average Mass | 862.83180 |
| Monoisotopic Mass | 862.29088 |
| IUPAC Name | 3-[(9S,10S,14S,15S)-9,14,20-tris(2-carboxyethyl)-5,10,15,19-tetrakis(carboxymethyl)-10,15-dimethyl-21,22,23,24-tetraazapentacyclo[16.2.1.1^{3,6}.1^{8,11}.1^{13,16}]tetracosa-1(20),2,4,6(24),7,11,13(22),16,18-nonaen-4-yl]propanoic acid |
| Traditional Name | 3-[(9s,10s,14s,15s)-9,14,20-tris(2-carboxyethyl)-5,10,15,19-tetrakis(carboxymethyl)-10,15-dimethyl-21,22,23,24-tetraazapentacyclo[16.2.1.1^{3,6}.1^{8,11}.1^{13,16}]tetracosa-1(20),2,4,6(24),7,11,13(22),16,18-nonaen-4-yl]propanoic acid |
| CAS Registry Number | 65207-12-7 |
| SMILES | C[C@@]1(CC(=O)[O-])c2cc3[nH]c(cc4nc(cc5[nH]c(cc(n2)[C@H]1CCC(=O)[O-])[C@@](C)(CC(=O)[O-])[C@@H]5CCC(=O)[O-])C(CC(=O)[O-])=C4CCC(=O)[O-])c(CCC(=O)[O-])c3CC(=O)[O-] |
| InChI Identifier | InChI=1S/C42H46N4O16/c1-41(17-39(59)60)23(5-9-35(51)52)29-14-27-21(11-37(55)56)19(3-7-33(47)48)25(43-27)13-26-20(4-8-34(49)50)22(12-38(57)58)28(44-26)15-31-42(2,18-40(61)62)24(6-10-36(53)54)30(46-31)16-32(41)45-29/h13-16,23-24,44-45H,3-12,17-18H2,1-2H3,(H,47,48)(H,49,50)(H,51,52)(H,53,54)(H,55,56)(H,57,58)(H,59,60)(H,61,62)/b25-13-,29-14-,31-15-,32-16-/t23-,24-,41+,42+/m1/s1 |
| InChI Key | KWIZRXMMFRBUML-AHGFGAHVSA-N |
| CHEBI ID | CHEBI:58351 |
| State | Not Available |
| Water Solubility | 2.52e-02 g/l |
| logP | 1.04 |
| logS | -4.54 |
| pKa (Strongest Acidic) | Not Available |
| pKa (Strongest Basic) | Not Available |
| Hydrogen Acceptor Count | 18 |
| Hydrogen Donor Count | 10 |
| Polar Surface Area | 355.76 Ų |
| Rotatable Bond Count | 20 |
| Physiological Charge | Not Available |
| Formal Charge | 0 |
| Refractivity | 209.38 m³·mol⁻¹ |
| Polarizability | 89.27 |