Showing Metabocard for (5S)-5-amino-3-oxohexanoate (BASm0003523)
| Common Name | (5s)-5-amino-3-oxohexanoate |
|---|---|
| Description | (S)-5-Amino-3-oxohexanoate is an intermediate in lysine degradation. L-Lysine is an essential amino acid that is a necessary building block for all protein in the body and It plays a major role in calcium absorption; building muscle protein; recovering from surgery or sports injuries; and the body's production of hormones, enzymes, and antibodies. In lysine degradation pathway, (S)-5-Amino-3-oxohexanoate is a substrate for the enzyme L-erythro-3,5-diaminohexanoate dehydrogenase (EC 1.4.1.11) and can be generated from L-erythro-3,5-Diaminohexanoate. |
| Structure | |
| Molecular Formula | C6H11NO3 |
| Average Mass | 145.15640 |
| Monoisotopic Mass | 145.07389 |
| IUPAC Name | (5S)-5-amino-3-oxohexanoic acid |
| Traditional Name | (5s)-5-amino-3-oxohexanoic acid |
| CAS Registry Number | 19355-90-9 |
| SMILES | C[C@H]([NH3+])CC(=O)CC(=O)[O-] |
| InChI Identifier | InChI=1S/C6H11NO3/c1-4(7)2-5(8)3-6(9)10/h4H,2-3,7H2,1H3,(H,9,10)/t4-/m0/s1 |
| InChI Key | FAASBXNEOGMQHS-BYPYZUCNSA-N |
| CHEBI ID | CHEBI:58523 |
| HMDB ID | HMDB0012131 |
| State | Solid |
| Water Solubility | 6.43e+01 g/l |
| logP | -2.45 |
| logS | -0.35 |
| pKa (Strongest Acidic) | 4.08 |
| pKa (Strongest Basic) | 9.89 |
| Hydrogen Acceptor Count | 4 |
| Hydrogen Donor Count | 2 |
| Polar Surface Area | 80.39 Ų |
| Rotatable Bond Count | 4 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 35.02 m³·mol⁻¹ |
| Polarizability | 14.24 |