Showing Metabocard for S-methyl-5-thio-alpha-D-ribose 1-phosphate (BASm0003533)
| Common Name | S-methyl-5-thio-alpha-d-ribose 1-phosphate |
|---|---|
| Description | 5-Methylthioribose 1-phosphate belongs to the class of organic compounds known as pentoses. These are monosaccharides in which the carbohydrate moiety contains five carbon atoms. 5-Methylthioribose 1-phosphate is an intermediate in methionine biosynthesis. It is converted from 5'-deoxy-5'-methylthioadenosine by 5'-deoxy-5'-methylthioadenosine phosphorylase. Then it is converted to methionine (PMID: 2153115 ). In the methionine salvage pathway, 5-methylthioribose 1-phosphate isomerase (M1Pi) catalyzes the conversion of 5-methylthioribose 1-phosphate (MTR-1-P) into 5-methylthioribulose 1-phosphate (MTRu-1-P). |
| Structure | |
| Molecular Formula | C6H13O7PS |
| Average Mass | 260.20200 |
| Monoisotopic Mass | 260.01196 |
| IUPAC Name | {[(3R,4S)-3,4-dihydroxy-5-[(methylsulfanyl)methyl]oxolan-2-yl]oxy}phosphonic acid |
| Traditional Name | [(3r,4s)-3,4-dihydroxy-5-[(methylsulfanyl)methyl]oxolan-2-yl]oxyphosphonic acid |
| CAS Registry Number | 68134-74-7 |
| SMILES | CSC[C@H]1O[C@H](OP(=O)([O-])[O-])[C@H](O)[C@@H]1O |
| InChI Identifier | InChI=1S/C6H13O7PS/c1-15-2-3-4(7)5(8)6(12-3)13-14(9,10)11/h3-8H,2H2,1H3,(H2,9,10,11)/t3-,4-,5-,6-/m1/s1 |
| InChI Key | JTFITTQBRJDSTL-KVTDHHQDSA-N |
| CHEBI ID | CHEBI:58533 |
| HMDB ID | HMDB0000963 |
| Pathways | |
| State | Solid |
| Water Solubility | 2.87e+01 g/l |
| logP | -1.16 |
| logS | -0.96 |
| pKa (Strongest Acidic) | 1.16 |
| pKa (Strongest Basic) | -3.66 |
| Hydrogen Acceptor Count | 6 |
| Hydrogen Donor Count | 4 |
| Polar Surface Area | 116.45 Ų |
| Rotatable Bond Count | 4 |
| Physiological Charge | -2 |
| Formal Charge | 0 |
| Refractivity | 51.67 m³·mol⁻¹ |
| Polarizability | 22.53 |