Showing Metabocard for alpha-D-glucose 1-phosphate (BASm0003583)
| Common Name | Alpha-d-glucose 1-phosphate |
|---|---|
| Description | Glucose 1-phosphate (also called cori ester) is a glucose molecule with a phosphate group on the 1'-carbon. It can exist in either the α- or β-anomeric form. Glucose 1-phosphate belongs to the class of organic compounds known as monosaccharide phosphates. These are monosaccharides comprising a phosphated group linked to the carbohydrate unit. Glucose 1-phosphate is the direct product of the reaction in which glycogen phosphorylase cleaves off a molecule of glucose from a greater glycogen structure. It cannot travel down many metabolic pathways and must be interconverted by the enzyme phosphoglucomutase in order to become glucose 6-phosphate. Free glucose 1-phosphate can also react with UTP to form UDP-glucose. It can then return to the greater glycogen structure via glycogen synthase. |
| Structure | |
| Molecular Formula | C6H13O9P |
| Average Mass | 260.13580 |
| Monoisotopic Mass | 260.02972 |
| IUPAC Name | {[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phosphonic acid |
| Traditional Name | [(3r,4s,5s,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphosphonic acid |
| CAS Registry Number | 59-56-3 |
| SMILES | O=P([O-])([O-])O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI Identifier | InChI=1S/C6H13O9P/c7-1-2-3(8)4(9)5(10)6(14-2)15-16(11,12)13/h2-10H,1H2,(H2,11,12,13)/t2-,3-,4+,5-,6-/m1/s1 |
| InChI Key | HXXFSFRBOHSIMQ-VFUOTHLCSA-N |
| CHEBI ID | CHEBI:58601 |
| HMDB ID | HMDB0001586 |
| State | Solid |
| Water Solubility | 3.23e+01 g/l |
| logP | -2.00 |
| logS | -0.91 |
| pKa (Strongest Acidic) | 1.16 |
| pKa (Strongest Basic) | -2.98 |
| Hydrogen Acceptor Count | 8 |
| Hydrogen Donor Count | 6 |
| Polar Surface Area | 156.91 Ų |
| Rotatable Bond Count | 3 |
| Physiological Charge | -2 |
| Formal Charge | 0 |
| Refractivity | 46.80 m³·mol⁻¹ |
| Polarizability | 20.66 |