Showing Metabocard for gamma-L-glutamylputrescine (BASm0003666)
| Common Name | Gamma-l-glutamylputrescine |
|---|---|
| Description | Gamma-glutamyl-L-putrescine is involved in the putrescine II degradation pathway. γ-glutamyl-L-putrescine reacts with H2O and O2 to produce γ-glutamyl-γ-aminobutyraldehyde, H2O2, and NH4+. γ-glutamyl-L-putrescine is formed from an ATP-driven reaction between putrescine, L-glutamate. |
| Structure | |
| Molecular Formula | C9H19N3O3 |
| Average Mass | 217.26550 |
| Monoisotopic Mass | 217.14264 |
| IUPAC Name | (2S)-2-amino-4-[(4-aminobutyl)carbamoyl]butanoic acid |
| Traditional Name | (2s)-2-amino-4-[(4-aminobutyl)carbamoyl]butanoic acid |
| CAS Registry Number | Not Available |
| SMILES | [NH3+]CCCCNC(=O)CC[C@H]([NH3+])C(=O)[O-] |
| InChI Identifier | InChI=1S/C9H19N3O3/c10-5-1-2-6-12-8(13)4-3-7(11)9(14)15/h7H,1-6,10-11H2,(H,12,13)(H,14,15)/t7-/m0/s1 |
| InChI Key | WKGTVHGVLRCTCF-ZETCQYMHSA-N |
| CHEBI ID | CHEBI:58731 |
| HMDB ID | HMDB0012230 |
| State | Solid |
| Water Solubility | 1.77e+01 g/l |
| logP | -3.42 |
| logS | -1.09 |
| pKa (Strongest Acidic) | 2.24 |
| pKa (Strongest Basic) | 10.00 |
| Hydrogen Acceptor Count | 5 |
| Hydrogen Donor Count | 4 |
| Polar Surface Area | 118.44 Ų |
| Rotatable Bond Count | 8 |
| Physiological Charge | 1 |
| Formal Charge | 0 |
| Refractivity | 55.47 m³·mol⁻¹ |
| Polarizability | 23.61 |